C18H22O6SSi — CID 23034522
2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-trimethylsilyloxyacetic acid (PubChem CID 23034522) has the molecular formula C18H22O6SSi and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-trimethylsilyloxyacetic acid.
| Compound Name | 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-trimethylsilyloxyacetic acid |
|---|---|
| PubChem CID | 23034522 |
| Molecular Formula | C18H22O6SSi |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-trimethylsilyloxyacetic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(O[Si](C)(C)C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H22O6SSi/c1-13-5-11-16(12-6-13)25(21,22)23-15-9-7-14(8-10-15)17(18(19)20)24-26(2,3)4/h5-12,17H,1-4H3,(H,19,20) |
| InChIKey | XFENMVACIYHPEK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|