C12H18O6SSi — CID 23034212
2-(3-methylsulfonyloxyphenyl)-2-trimethylsilyloxyacetic acid (PubChem CID 23034212) has the molecular formula C12H18O6SSi and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(3-methylsulfonyloxyphenyl)-2-trimethylsilyloxyacetic acid.
| Compound Name | 2-(3-methylsulfonyloxyphenyl)-2-trimethylsilyloxyacetic acid |
|---|---|
| PubChem CID | 23034212 |
| Molecular Formula | C12H18O6SSi |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-(3-methylsulfonyloxyphenyl)-2-trimethylsilyloxyacetic acid |
| SMILES | C[Si](C)(C)OC(C(=O)O)c1cccc(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H18O6SSi/c1-19(15,16)17-10-7-5-6-9(8-10)11(12(13)14)18-20(2,3)4/h5-8,11H,1-4H3,(H,13,14) |
| InChIKey | IBVAZIPYFHPGFP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|