C18H24F3NO4S — CID 68525453
tert-butyl 3-[2-[3-(trifluoromethyl)phenyl]sulfonylpropyl]azetidine-1-carboxylate (PubChem CID 68525453) has the molecular formula C18H24F3NO4S and a molecular weight of 407.45 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-(trifluoromethyl)phenyl]sulfonylpropyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[3-(trifluoromethyl)phenyl]sulfonylpropyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 68525453 |
| Molecular Formula | C18H24F3NO4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | tert-butyl 3-[2-[3-(trifluoromethyl)phenyl]sulfonylpropyl]azetidine-1-carboxylate |
| SMILES | CC(CC1CN(C(=O)OC(C)(C)C)C1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H24F3NO4S/c1-12(8-13-10-22(11-13)16(23)26-17(2,3)4)27(24,25)15-7-5-6-14(9-15)18(19,20)21/h5-7,9,12-13H,8,10-11H2,1-4H3 |
| InChIKey | SZUNXFNDZVLZEL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |