C19H24F3NO3 — CID 146380757
tert-butyl 3-[2-[2-acetyl-4-(trifluoromethyl)phenyl]ethyl]azetidine-1-carboxylate (PubChem CID 146380757) has the molecular formula C19H24F3NO3 and a molecular weight of 371.40 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-acetyl-4-(trifluoromethyl)phenyl]ethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[2-acetyl-4-(trifluoromethyl)phenyl]ethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 146380757 |
| Molecular Formula | C19H24F3NO3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | tert-butyl 3-[2-[2-acetyl-4-(trifluoromethyl)phenyl]ethyl]azetidine-1-carboxylate |
| SMILES | CC(=O)c1cc(C(F)(F)F)ccc1CCC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H24F3NO3/c1-12(24)16-9-15(19(20,21)22)8-7-14(16)6-5-13-10-23(11-13)17(25)26-18(2,3)4/h7-9,13H,5-6,10-11H2,1-4H3 |
| InChIKey | NPUNGHXXWBKMNV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |