C17H24ClNO2 — CID 159708612
tert-butyl 3-[2-(4-chloro-3-methylphenyl)ethyl]azetidine-1-carboxylate (PubChem CID 159708612) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-chloro-3-methylphenyl)ethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(4-chloro-3-methylphenyl)ethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 159708612 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | tert-butyl 3-[2-(4-chloro-3-methylphenyl)ethyl]azetidine-1-carboxylate |
| SMILES | Cc1cc(CCC2CN(C(=O)OC(C)(C)C)C2)ccc1Cl |
| InChI | InChI=1S/C17H24ClNO2/c1-12-9-13(7-8-15(12)18)5-6-14-10-19(11-14)16(20)21-17(2,3)4/h7-9,14H,5-6,10-11H2,1-4H3 |
| InChIKey | YPGQKDKHTHMIBF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |