C17H22ClNO3 — CID 165484487
tert-butyl 3-[(4-chloro-3-methylphenyl)methyl]-4-oxopyrrolidine-1-carboxylate (PubChem CID 165484487) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is tert-butyl 3-[(4-chloro-3-methylphenyl)methyl]-4-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-chloro-3-methylphenyl)methyl]-4-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 165484487 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | tert-butyl 3-[(4-chloro-3-methylphenyl)methyl]-4-oxopyrrolidine-1-carboxylate |
| SMILES | Cc1cc(CC2CN(C(=O)OC(C)(C)C)CC2=O)ccc1Cl |
| InChI | InChI=1S/C17H22ClNO3/c1-11-7-12(5-6-14(11)18)8-13-9-19(10-15(13)20)16(21)22-17(2,3)4/h5-7,13H,8-10H2,1-4H3 |
| InChIKey | QXARLSPYSUQCSF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |