C16H19F4NO2S — CID 150216462
tert-butyl 3-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]azetidine-1-carboxylate (PubChem CID 150216462) has the molecular formula C16H19F4NO2S and a molecular weight of 365.39 g/mol. Its IUPAC name is tert-butyl 3-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 150216462 |
| Molecular Formula | C16H19F4NO2S |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | tert-butyl 3-[[2-fluoro-4-(trifluoromethyl)phenyl]methylsulfanyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(SCc2ccc(C(F)(F)F)cc2F)C1 |
| InChI | InChI=1S/C16H19F4NO2S/c1-15(2,3)23-14(22)21-7-12(8-21)24-9-10-4-5-11(6-13(10)17)16(18,19)20/h4-6,12H,7-9H2,1-3H3 |
| InChIKey | FSORQXHNAHOLHP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |