C19H18F3NO4S — CID 160845254
N-hydroxy-7-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 160845254) has the molecular formula C19H18F3NO4S and a molecular weight of 413.42 g/mol. Its IUPAC name is N-hydroxy-7-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-hydroxy-7-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 160845254 |
| Molecular Formula | C19H18F3NO4S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-hydroxy-7-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CC(CS(=O)(=O)c1cccc(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C19H18F3NO4S/c20-19(21,22)16-2-1-3-17(10-16)28(26,27)11-12-4-5-13-6-7-14(18(24)23-25)9-15(13)8-12/h1-3,6-7,9-10,12,25H,4-5,8,11H2,(H,23,24) |
| InChIKey | SIODLTWRTHQKCW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|