C25H27F6N3O6S — CID 87463349
N-[2-[[(1S,2R,4R)-4-amino-2-(benzenesulfonylmethyl)cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 87463349) has the molecular formula C25H27F6N3O6S and a molecular weight of 611.56 g/mol. Its IUPAC name is N-[2-[[(1S,2R,4R)-4-amino-2-(benzenesulfonylmethyl)cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[[(1S,2R,4R)-4-amino-2-(benzenesulfonylmethyl)cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87463349 |
| Molecular Formula | C25H27F6N3O6S |
| Molecular Weight | 611.56 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | N-[2-[[(1S,2R,4R)-4-amino-2-(benzenesulfonylmethyl)cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H]1CC[C@H](NC(=O)CNC(=O)c2cccc(C(F)(F)F)c2)[C@H](CS(=O)(=O)c2ccccc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H26F3N3O4S.C2HF3O2/c24-23(25,26)17-6-4-5-15(11-17)22(31)28-13-21(30)29-20-10-9-18(27)12-16(20)14-34(32,33)19-7-2-1-3-8-19;3-2(4,5)1(6)7/h1-8,11,16,18,20H,9-10,12-14,27H2,(H,28,31)(H,29,30);(H,6,7)/t16-,18+,20-;/m0./s1 |
| InChIKey | JXDUYSHXAAWNGW-HHPHJXMXSA-N |
| XLogP | 3.15 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |