C25H30F3N5O4S2 — CID 10196769
N-[2-[[(1S,2R,4R)-4-(diaminomethylideneamino)-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 10196769) has the molecular formula C25H30F3N5O4S2 and a molecular weight of 585.67 g/mol. Its IUPAC name is N-[2-[[(1S,2R,4R)-4-(diaminomethylideneamino)-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(1S,2R,4R)-4-(diaminomethylideneamino)-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 10196769 |
| Molecular Formula | C25H30F3N5O4S2 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | N-[2-[[(1S,2R,4R)-4-(diaminomethylideneamino)-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CSc1ccc(S(=O)(=O)C[C@@H]2C[C@H](N=C(N)N)CC[C@@H]2NC(=O)CNC(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H30F3N5O4S2/c1-38-19-6-8-20(9-7-19)39(36,37)14-16-12-18(32-24(29)30)5-10-21(16)33-22(34)13-31-23(35)15-3-2-4-17(11-15)25(26,27)28/h2-4,6-9,11,16,18,21H,5,10,12-14H2,1H3,(H,31,35)(H,33,34)(H4,29,30,32)/t16-,18+,21-/m0/s1 |
| InChIKey | MWQLEJFTECBGAS-CDXJDZJCSA-N |
| XLogP | 2.56 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|