C27H30F3N5O4S2 — CID 91333247
N-[(3S)-1-[(1S,2R,4R)-4-azido-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]-3-methyl-2-oxopyrrolidin-3-yl]-3-(trifluoromethyl)benzamide (PubChem CID 91333247) has the molecular formula C27H30F3N5O4S2 and a molecular weight of 609.70 g/mol. Its IUPAC name is N-[(3S)-1-[(1S,2R,4R)-4-azido-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]-3-methyl-2-oxopyrrolidin-3-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(3S)-1-[(1S,2R,4R)-4-azido-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]-3-methyl-2-oxopyrrolidin-3-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91333247 |
| Molecular Formula | C27H30F3N5O4S2 |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | N-[(3S)-1-[(1S,2R,4R)-4-azido-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]-3-methyl-2-oxopyrrolidin-3-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CSc1ccc(S(=O)(=O)C[C@@H]2C[C@H](N=[N+]=[N-])CC[C@@H]2N2CC[C@](C)(NC(=O)c3cccc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H30F3N5O4S2/c1-26(32-24(36)17-4-3-5-19(14-17)27(28,29)30)12-13-35(25(26)37)23-11-6-20(33-34-31)15-18(23)16-41(38,39)22-9-7-21(40-2)8-10-22/h3-5,7-10,14,18,20,23H,6,11-13,15-16H2,1-2H3,(H,32,36)/t18-,20+,23-,26-/m0/s1 |
| InChIKey | ZFGBXLPELLESSF-PLDOSFOGSA-N |
| XLogP | 5.47 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|