C25H25F3N4O4S — CID 91427347
(3R)-1-[(1S,2S,4S)-4-azido-2-(benzenesulfonylmethyl)cyclohexyl]-3-[3-(trifluoromethyl)benzoyl]pyrrolidin-2-one (PubChem CID 91427347) has the molecular formula C25H25F3N4O4S and a molecular weight of 534.56 g/mol. Its IUPAC name is (3R)-1-[(1S,2S,4S)-4-azido-2-(benzenesulfonylmethyl)cyclohexyl]-3-[3-(trifluoromethyl)benzoyl]pyrrolidin-2-one.
| Compound Name | (3R)-1-[(1S,2S,4S)-4-azido-2-(benzenesulfonylmethyl)cyclohexyl]-3-[3-(trifluoromethyl)benzoyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91427347 |
| Molecular Formula | C25H25F3N4O4S |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | (3R)-1-[(1S,2S,4S)-4-azido-2-(benzenesulfonylmethyl)cyclohexyl]-3-[3-(trifluoromethyl)benzoyl]pyrrolidin-2-one |
| SMILES | [N-]=[N+]=N[C@H]1CC[C@H](N2CC[C@H](C(=O)c3cccc(C(F)(F)F)c3)C2=O)[C@@H](CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C25H25F3N4O4S/c26-25(27,28)18-6-4-5-16(13-18)23(33)21-11-12-32(24(21)34)22-10-9-19(30-31-29)14-17(22)15-37(35,36)20-7-2-1-3-8-20/h1-8,13,17,19,21-22H,9-12,14-15H2/t17-,19+,21-,22+/m1/s1 |
| InChIKey | PRXPJENGUOSESF-YKWDRNOUSA-N |
| XLogP | 5.06 |
| TPSA | 120.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|