C21H30N2O5S — CID 69034064
1-[(1S,2S)-2-(benzenesulfonylmethyl)-4-(propan-2-ylamino)cyclohexyl]-2-oxopyrrolidine-3-carboxylic acid (PubChem CID 69034064) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-[(1S,2S)-2-(benzenesulfonylmethyl)-4-(propan-2-ylamino)cyclohexyl]-2-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(1S,2S)-2-(benzenesulfonylmethyl)-4-(propan-2-ylamino)cyclohexyl]-2-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 69034064 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1-[(1S,2S)-2-(benzenesulfonylmethyl)-4-(propan-2-ylamino)cyclohexyl]-2-oxopyrrolidine-3-carboxylic acid |
| SMILES | CC(C)NC1CC[C@H](N2CCC(C(=O)O)C2=O)[C@@H](CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H30N2O5S/c1-14(2)22-16-8-9-19(23-11-10-18(20(23)24)21(25)26)15(12-16)13-29(27,28)17-6-4-3-5-7-17/h3-7,14-16,18-19,22H,8-13H2,1-2H3,(H,25,26)/t15-,16?,18?,19+/m1/s1 |
| InChIKey | ZHZRSVMVGIJHAH-JVDULTGUSA-N |
| XLogP | 1.93 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|