C30H34O6 — CID 126723502
(3R,7R)-7-methoxy-3,6-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxepane-4-carbaldehyde (PubChem CID 126723502) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is (3R,7R)-7-methoxy-3,6-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxepane-4-carbaldehyde.
| Compound Name | (3R,7R)-7-methoxy-3,6-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxepane-4-carbaldehyde |
|---|---|
| PubChem CID | 126723502 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (3R,7R)-7-methoxy-3,6-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxepane-4-carbaldehyde |
| SMILES | CO[C@@H]1OC(COCc2ccccc2)[C@H](OCc2ccccc2)C(C=O)CC1OCc1ccccc1 |
| InChI | InChI=1S/C30H34O6/c1-32-30-27(34-20-24-13-7-3-8-14-24)17-26(18-31)29(35-21-25-15-9-4-10-16-25)28(36-30)22-33-19-23-11-5-2-6-12-23/h2-16,18,26-30H,17,19-22H2,1H3/t26?,27?,28?,29-,30-/m1/s1 |
| InChIKey | BBYXPCSPGXTQIF-YQNGGHKHSA-N |
| XLogP | 4.95 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|