C16H20O3 — CID 177460462
2-(2-phenylmethoxybutan-2-yl)-2,3-dihydropyran-4-one (PubChem CID 177460462) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-(2-phenylmethoxybutan-2-yl)-2,3-dihydropyran-4-one.
| Compound Name | 2-(2-phenylmethoxybutan-2-yl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 177460462 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-(2-phenylmethoxybutan-2-yl)-2,3-dihydropyran-4-one |
| SMILES | CCC(C)(OCc1ccccc1)C1CC(=O)C=CO1 |
| InChI | InChI=1S/C16H20O3/c1-3-16(2,15-11-14(17)9-10-18-15)19-12-13-7-5-4-6-8-13/h4-10,15H,3,11-12H2,1-2H3 |
| InChIKey | SKJDPGHTSORJSB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |