C14H18O5 — CID 71481806
(3S,6S)-3-methoxy-6-(2-phenylmethoxyethyl)-1,4-dioxan-2-one (PubChem CID 71481806) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (3S,6S)-3-methoxy-6-(2-phenylmethoxyethyl)-1,4-dioxan-2-one.
| Compound Name | (3S,6S)-3-methoxy-6-(2-phenylmethoxyethyl)-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 71481806 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (3S,6S)-3-methoxy-6-(2-phenylmethoxyethyl)-1,4-dioxan-2-one |
| SMILES | CO[C@H]1OC[C@H](CCOCc2ccccc2)OC1=O |
| InChI | InChI=1S/C14H18O5/c1-16-14-13(15)19-12(10-18-14)7-8-17-9-11-5-3-2-4-6-11/h2-6,12,14H,7-10H2,1H3/t12-,14-/m0/s1 |
| InChIKey | GLCBVPTXBCWHQZ-JSGCOSHPSA-N |
| XLogP | 1.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|