C17H22O3 — CID 101251165
(4Z)-2-(2-phenylmethoxyethyl)-3,6,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 101251165) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4Z)-2-(2-phenylmethoxyethyl)-3,6,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (4Z)-2-(2-phenylmethoxyethyl)-3,6,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 101251165 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (4Z)-2-(2-phenylmethoxyethyl)-3,6,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | O=C1CCC/C=C\CC(CCOCc2ccccc2)O1 |
| InChI | InChI=1S/C17H22O3/c18-17-11-7-2-1-6-10-16(20-17)12-13-19-14-15-8-4-3-5-9-15/h1,3-6,8-9,16H,2,7,10-14H2/b6-1- |
| InChIKey | HYXJCDZMCBFFTB-BHQIHCQQSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|