C16H21N3O3 — CID 102319333
(6R,8S)-6-azido-8-(2-phenylmethoxyethyl)oxocan-2-one (PubChem CID 102319333) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is (6R,8S)-6-azido-8-(2-phenylmethoxyethyl)oxocan-2-one.
| Compound Name | (6R,8S)-6-azido-8-(2-phenylmethoxyethyl)oxocan-2-one |
|---|---|
| PubChem CID | 102319333 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (6R,8S)-6-azido-8-(2-phenylmethoxyethyl)oxocan-2-one |
| SMILES | [N-]=[N+]=N[C@@H]1CCCC(=O)O[C@H](CCOCc2ccccc2)C1 |
| InChI | InChI=1S/C16H21N3O3/c17-19-18-14-7-4-8-16(20)22-15(11-14)9-10-21-12-13-5-2-1-3-6-13/h1-3,5-6,14-15H,4,7-12H2/t14-,15-/m1/s1 |
| InChIKey | GPQVMMURFSLLSK-HUUCEWRRSA-N |
| XLogP | 3.76 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|