C21H31IO4 — CID 101245940
(7R,8S,10S)-7-iodo-8-[(2-methylpropan-2-yl)oxy]-10-(phenylmethoxymethyl)oxecan-2-one (PubChem CID 101245940) has the molecular formula C21H31IO4 and a molecular weight of 474.38 g/mol. Its IUPAC name is (7R,8S,10S)-7-iodo-8-[(2-methylpropan-2-yl)oxy]-10-(phenylmethoxymethyl)oxecan-2-one.
| Compound Name | (7R,8S,10S)-7-iodo-8-[(2-methylpropan-2-yl)oxy]-10-(phenylmethoxymethyl)oxecan-2-one |
|---|---|
| PubChem CID | 101245940 |
| Molecular Formula | C21H31IO4 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | (7R,8S,10S)-7-iodo-8-[(2-methylpropan-2-yl)oxy]-10-(phenylmethoxymethyl)oxecan-2-one |
| SMILES | CC(C)(C)O[C@H]1C[C@@H](COCc2ccccc2)OC(=O)CCCC[C@H]1I |
| InChI | InChI=1S/C21H31IO4/c1-21(2,3)26-19-13-17(15-24-14-16-9-5-4-6-10-16)25-20(23)12-8-7-11-18(19)22/h4-6,9-10,17-19H,7-8,11-15H2,1-3H3/t17-,18+,19-/m0/s1 |
| InChIKey | NBWZQZQPAFBNHT-OTWHNJEPSA-N |
| XLogP | 5.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|