C17H19NO4S — CID 155466541
4-(2-phenylmethoxyethyl)-3,4-dihydro-2H-5,1λ6,2-benzoxathiazepine 1,1-dioxide (PubChem CID 155466541) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-(2-phenylmethoxyethyl)-3,4-dihydro-2H-5,1λ6,2-benzoxathiazepine 1,1-dioxide.
| Compound Name | 4-(2-phenylmethoxyethyl)-3,4-dihydro-2H-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 155466541 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-(2-phenylmethoxyethyl)-3,4-dihydro-2H-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
| SMILES | O=S1(=O)NCC(CCOCc2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C17H19NO4S/c19-23(20)17-9-5-4-8-16(17)22-15(12-18-23)10-11-21-13-14-6-2-1-3-7-14/h1-9,15,18H,10-13H2 |
| InChIKey | ZBWBQFCICGYYII-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|