C21H27O3P — CID 159484392
(2R,3R,4S,5S,6R)-6-ethyl-3,5-dimethyl-2-phenyl-4-phenylmethoxy-1,2λ5-oxaphosphinane 2-oxide (PubChem CID 159484392) has the molecular formula C21H27O3P and a molecular weight of 358.42 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-ethyl-3,5-dimethyl-2-phenyl-4-phenylmethoxy-1,2λ5-oxaphosphinane 2-oxide.
| Compound Name | (2R,3R,4S,5S,6R)-6-ethyl-3,5-dimethyl-2-phenyl-4-phenylmethoxy-1,2λ5-oxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 159484392 |
| Molecular Formula | C21H27O3P |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-ethyl-3,5-dimethyl-2-phenyl-4-phenylmethoxy-1,2λ5-oxaphosphinane 2-oxide |
| SMILES | CC[C@H]1O[P@@](=O)(c2ccccc2)[C@H](C)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C21H27O3P/c1-4-20-16(2)21(23-15-18-11-7-5-8-12-18)17(3)25(22,24-20)19-13-9-6-10-14-19/h5-14,16-17,20-21H,4,15H2,1-3H3/t16-,17-,20-,21+,25-/m1/s1 |
| InChIKey | LXKBWJQNFXRMCJ-CALCFPFYSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|