C22H37O4P — CID 59585304
(5S,6R)-6-ethyl-5-methyl-2-octyl-2-oxo-4-phenylmethoxy-1,2λ5-oxaphosphinan-3-ol (PubChem CID 59585304) has the molecular formula C22H37O4P and a molecular weight of 396.51 g/mol. Its IUPAC name is (5S,6R)-6-ethyl-5-methyl-2-octyl-2-oxo-4-phenylmethoxy-1,2λ5-oxaphosphinan-3-ol.
| Compound Name | (5S,6R)-6-ethyl-5-methyl-2-octyl-2-oxo-4-phenylmethoxy-1,2λ5-oxaphosphinan-3-ol |
|---|---|
| PubChem CID | 59585304 |
| Molecular Formula | C22H37O4P |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | (5S,6R)-6-ethyl-5-methyl-2-octyl-2-oxo-4-phenylmethoxy-1,2λ5-oxaphosphinan-3-ol |
| SMILES | CCCCCCCCP1(=O)O[C@H](CC)[C@@H](C)C(OCc2ccccc2)C1O |
| InChI | InChI=1S/C22H37O4P/c1-4-6-7-8-9-13-16-27(24)22(23)21(18(3)20(5-2)26-27)25-17-19-14-11-10-12-15-19/h10-12,14-15,18,20-23H,4-9,13,16-17H2,1-3H3/t18-,20-,21?,22?,27?/m1/s1 |
| InChIKey | ZFNVWAMCACGMBF-KBBKLXKSSA-N |
| XLogP | 5.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|