C20H24N3O3P — CID 118602915
3-azido-6-ethyl-5-methyl-2-phenyl-4-phenylmethoxy-1,2λ5-oxaphosphinane 2-oxide (PubChem CID 118602915) has the molecular formula C20H24N3O3P and a molecular weight of 385.40 g/mol. Its IUPAC name is 3-azido-6-ethyl-5-methyl-2-phenyl-4-phenylmethoxy-1,2λ5-oxaphosphinane 2-oxide.
| Compound Name | 3-azido-6-ethyl-5-methyl-2-phenyl-4-phenylmethoxy-1,2λ5-oxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 118602915 |
| Molecular Formula | C20H24N3O3P |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 3-azido-6-ethyl-5-methyl-2-phenyl-4-phenylmethoxy-1,2λ5-oxaphosphinane 2-oxide |
| SMILES | CCC1OP(=O)(c2ccccc2)C(N=[N+]=[N-])C(OCc2ccccc2)C1C |
| InChI | InChI=1S/C20H24N3O3P/c1-3-18-15(2)19(25-14-16-10-6-4-7-11-16)20(22-23-21)27(24,26-18)17-12-8-5-9-13-17/h4-13,15,18-20H,3,14H2,1-2H3 |
| InChIKey | ULOBYRLDYHEAPA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|