C32H32BrO5P — CID 122195669
(2S,3S,4S,5S,6R)-3-bromo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinane 2-oxide (PubChem CID 122195669) has the molecular formula C32H32BrO5P and a molecular weight of 607.48 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-3-bromo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinane 2-oxide.
| Compound Name | (2S,3S,4S,5S,6R)-3-bromo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 122195669 |
| Molecular Formula | C32H32BrO5P |
| Molecular Weight | 607.48 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | (2S,3S,4S,5S,6R)-3-bromo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinane 2-oxide |
| SMILES | O=[P@@]1(c2ccccc2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1Br |
| InChI | InChI=1S/C32H32BrO5P/c33-32-31(37-23-27-17-9-3-10-18-27)30(36-22-26-15-7-2-8-16-26)29(24-35-21-25-13-5-1-6-14-25)38-39(32,34)28-19-11-4-12-20-28/h1-20,29-32H,21-24H2/t29-,30-,31+,32-,39+/m1/s1 |
| InChIKey | ZPSZTAGDELOFFG-IIXSRDTASA-N |
| XLogP | 7.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.48 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|