C34H35O6PS2 — CID 70687984
O-[(2S,3R,4S,5S,6R)-2-oxo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinan-3-yl] methylsulfanylmethanethioate (PubChem CID 70687984) has the molecular formula C34H35O6PS2 and a molecular weight of 634.76 g/mol. Its IUPAC name is O-[(2S,3R,4S,5S,6R)-2-oxo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinan-3-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(2S,3R,4S,5S,6R)-2-oxo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinan-3-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 70687984 |
| Molecular Formula | C34H35O6PS2 |
| Molecular Weight | 634.76 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | O-[(2S,3R,4S,5S,6R)-2-oxo-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinan-3-yl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)O[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[P@@]1(=O)c1ccccc1 |
| InChI | InChI=1S/C34H35O6PS2/c1-43-34(42)39-33-32(38-24-28-18-10-4-11-19-28)31(37-23-27-16-8-3-9-17-27)30(25-36-22-26-14-6-2-7-15-26)40-41(33,35)29-20-12-5-13-21-29/h2-21,30-33H,22-25H2,1H3/t30-,31-,32+,33-,41+/m1/s1 |
| InChIKey | TXEXVRYZPABFEH-XJBRRWOYSA-N |
| XLogP | 7.37 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.76 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|