C33H35O6P — CID 70690006
(2S,3S,4S,5S,6R)-2-(3-methylphenyl)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinan-3-ol (PubChem CID 70690006) has the molecular formula C33H35O6P and a molecular weight of 558.61 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-2-(3-methylphenyl)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinan-3-ol.
| Compound Name | (2S,3S,4S,5S,6R)-2-(3-methylphenyl)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinan-3-ol |
|---|---|
| PubChem CID | 70690006 |
| Molecular Formula | C33H35O6P |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-(3-methylphenyl)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinan-3-ol |
| SMILES | Cc1cccc([P@]2(=O)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O)c1 |
| InChI | InChI=1S/C33H35O6P/c1-25-12-11-19-29(20-25)40(35)33(34)32(38-23-28-17-9-4-10-18-28)31(37-22-27-15-7-3-8-16-27)30(39-40)24-36-21-26-13-5-2-6-14-26/h2-20,30-34H,21-24H2,1H3/t30-,31-,32+,33+,40+/m1/s1 |
| InChIKey | GCEPZBATEXBZSU-JRHRXQGKSA-N |
| XLogP | 6.00 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|