C40H46O6S — CID 10580163
S-[(2S,3R,4S,5R,6R)-3,4,5-tris[(3-methylphenyl)methoxy]-6-[(3-methylphenyl)methoxymethyl]oxan-2-yl] ethanethioate (PubChem CID 10580163) has the molecular formula C40H46O6S and a molecular weight of 654.87 g/mol. Its IUPAC name is S-[(2S,3R,4S,5R,6R)-3,4,5-tris[(3-methylphenyl)methoxy]-6-[(3-methylphenyl)methoxymethyl]oxan-2-yl] ethanethioate.
| Compound Name | S-[(2S,3R,4S,5R,6R)-3,4,5-tris[(3-methylphenyl)methoxy]-6-[(3-methylphenyl)methoxymethyl]oxan-2-yl] ethanethioate |
|---|---|
| PubChem CID | 10580163 |
| Molecular Formula | C40H46O6S |
| Molecular Weight | 654.87 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | S-[(2S,3R,4S,5R,6R)-3,4,5-tris[(3-methylphenyl)methoxy]-6-[(3-methylphenyl)methoxymethyl]oxan-2-yl] ethanethioate |
| SMILES | CC(=O)S[C@@H]1O[C@H](COCc2cccc(C)c2)[C@@H](OCc2cccc(C)c2)[C@H](OCc2cccc(C)c2)[C@H]1OCc1cccc(C)c1 |
| InChI | InChI=1S/C40H46O6S/c1-27-10-6-14-32(18-27)22-42-26-36-37(43-23-33-15-7-11-28(2)19-33)38(44-24-34-16-8-12-29(3)20-34)39(40(46-36)47-31(5)41)45-25-35-17-9-13-30(4)21-35/h6-21,36-40H,22-26H2,1-5H3/t36-,37-,38+,39-,40+/m1/s1 |
| InChIKey | GQPDVZHFPPOPQI-DTQLOPILSA-N |
| XLogP | 8.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.87 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|