C40H40O5SSe — CID 102503657
(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylselanylsulfanyloxane (PubChem CID 102503657) has the molecular formula C40H40O5SSe and a molecular weight of 711.78 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylselanylsulfanyloxane.
| Compound Name | (2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylselanylsulfanyloxane |
|---|---|
| PubChem CID | 102503657 |
| Molecular Formula | C40H40O5SSe |
| Molecular Weight | 711.78 g/mol |
| Exact Mass | 712.18 |
| IUPAC Name | (2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylselanylsulfanyloxane |
| SMILES | c1ccc(COC[C@H]2O[C@@H](S[Se]c3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C40H40O5SSe/c1-6-16-31(17-7-1)26-41-30-36-37(42-27-32-18-8-2-9-19-32)38(43-28-33-20-10-3-11-21-33)39(44-29-34-22-12-4-13-23-34)40(45-36)46-47-35-24-14-5-15-25-35/h1-25,36-40H,26-30H2/t36-,37-,38+,39-,40+/m1/s1 |
| InChIKey | RJKZCIXWGXPOHR-DTQLOPILSA-N |
| XLogP | 7.36 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.78 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|