C46H50O8 — CID 10795037
2-[[(3R,4S,5R,6R)-3,4,5-tris[(3-methylphenyl)methoxy]-6-[(3-methylphenyl)methoxymethyl]oxan-2-yl]oxymethyl]benzoic acid (PubChem CID 10795037) has the molecular formula C46H50O8 and a molecular weight of 730.90 g/mol. Its IUPAC name is 2-[[(3R,4S,5R,6R)-3,4,5-tris[(3-methylphenyl)methoxy]-6-[(3-methylphenyl)methoxymethyl]oxan-2-yl]oxymethyl]benzoic acid.
| Compound Name | 2-[[(3R,4S,5R,6R)-3,4,5-tris[(3-methylphenyl)methoxy]-6-[(3-methylphenyl)methoxymethyl]oxan-2-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 10795037 |
| Molecular Formula | C46H50O8 |
| Molecular Weight | 730.90 g/mol |
| Exact Mass | 730.35 |
| IUPAC Name | 2-[[(3R,4S,5R,6R)-3,4,5-tris[(3-methylphenyl)methoxy]-6-[(3-methylphenyl)methoxymethyl]oxan-2-yl]oxymethyl]benzoic acid |
| SMILES | Cc1cccc(COC[C@H]2OC(OCc3ccccc3C(=O)O)[C@H](OCc3cccc(C)c3)[C@@H](OCc3cccc(C)c3)[C@@H]2OCc2cccc(C)c2)c1 |
| InChI | InChI=1S/C46H50O8/c1-31-11-7-15-35(21-31)25-49-30-41-42(50-26-36-16-8-12-32(2)22-36)43(51-27-37-17-9-13-33(3)23-37)44(52-28-38-18-10-14-34(4)24-38)46(54-41)53-29-39-19-5-6-20-40(39)45(47)48/h5-24,41-44,46H,25-30H2,1-4H3,(H,47,48)/t41-,42-,43+,44-,46?/m1/s1 |
| InChIKey | OPKWDQYWGWNPJT-OARDSTIBSA-N |
| XLogP | 8.83 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.90 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |