C30H31O6PS — CID 25154959
(4S,5S,6R)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-thiophen-2-yl-1,2λ5-oxaphosphinan-3-ol (PubChem CID 25154959) has the molecular formula C30H31O6PS and a molecular weight of 550.61 g/mol. Its IUPAC name is (4S,5S,6R)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-thiophen-2-yl-1,2λ5-oxaphosphinan-3-ol.
| Compound Name | (4S,5S,6R)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-thiophen-2-yl-1,2λ5-oxaphosphinan-3-ol |
|---|---|
| PubChem CID | 25154959 |
| Molecular Formula | C30H31O6PS |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | (4S,5S,6R)-2-oxo-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-thiophen-2-yl-1,2λ5-oxaphosphinan-3-ol |
| SMILES | O=P1(c2cccs2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1O |
| InChI | InChI=1S/C30H31O6PS/c31-30-29(35-21-25-15-8-3-9-16-25)28(34-20-24-13-6-2-7-14-24)26(22-33-19-23-11-4-1-5-12-23)36-37(30,32)27-17-10-18-38-27/h1-18,26,28-31H,19-22H2/t26-,28-,29+,30?,37?/m1/s1 |
| InChIKey | IGFXXBSRPRQJSY-SDWLLUMZSA-N |
| XLogP | 5.76 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|