C50H53NO6 — CID 53466554
3-[diphenyl-[3-[(2S,3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropoxy]methyl]-N,N-dimethylaniline (PubChem CID 53466554) has the molecular formula C50H53NO6 and a molecular weight of 763.98 g/mol. Its IUPAC name is 3-[diphenyl-[3-[(2S,3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropoxy]methyl]-N,N-dimethylaniline.
| Compound Name | 3-[diphenyl-[3-[(2S,3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropoxy]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53466554 |
| Molecular Formula | C50H53NO6 |
| Molecular Weight | 763.98 g/mol |
| Exact Mass | 763.39 |
| IUPAC Name | 3-[diphenyl-[3-[(2S,3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxypropoxy]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C(OCCCO[C@H]2OC[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C50H53NO6/c1-51(2)45-31-18-30-44(34-45)50(42-26-14-6-15-27-42,43-28-16-7-17-29-43)57-33-19-32-52-49-48(55-37-41-24-12-5-13-25-41)47(54-36-40-22-10-4-11-23-40)46(38-56-49)53-35-39-20-8-3-9-21-39/h3-18,20-31,34,46-49H,19,32-33,35-38H2,1-2H3/t46-,47+,48-,49+/m1/s1 |
| InChIKey | VGLSECPENKRKCT-HAKTVMAJSA-N |
| XLogP | 9.58 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.98 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|