C16H32O6 — CID 70171890
(2S,3R,4S,5S)-3-decoxy-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,4-diol (PubChem CID 70171890) has the molecular formula C16H32O6 and a molecular weight of 320.43 g/mol. Its IUPAC name is (2S,3R,4S,5S)-3-decoxy-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,4-diol.
| Compound Name | (2S,3R,4S,5S)-3-decoxy-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,4-diol |
|---|---|
| PubChem CID | 70171890 |
| Molecular Formula | C16H32O6 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (2S,3R,4S,5S)-3-decoxy-5-[(1R)-1,2-dihydroxyethyl]oxolane-2,4-diol |
| SMILES | CCCCCCCCCCO[C@@H]1[C@@H](O)[C@H]([C@H](O)CO)O[C@@H]1O |
| InChI | InChI=1S/C16H32O6/c1-2-3-4-5-6-7-8-9-10-21-15-13(19)14(12(18)11-17)22-16(15)20/h12-20H,2-11H2,1H3/t12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | WXVUFQDDOLIXHO-CWVYHPPDSA-N |
| XLogP | 0.94 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|