C38H58O7 — CID 89468664
4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]benzoic acid (PubChem CID 89468664) has the molecular formula C38H58O7 and a molecular weight of 626.88 g/mol. Its IUPAC name is 4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]benzoic acid.
| Compound Name | 4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 89468664 |
| Molecular Formula | C38H58O7 |
| Molecular Weight | 626.88 g/mol |
| Exact Mass | 626.42 |
| IUPAC Name | 4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]benzoic acid |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cc(Cc3ccc(CC)cc3)ccc2C(=O)O)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C38H58O7/c1-6-11-21-41-27-33-35(42-22-12-7-2)37(44-24-14-9-4)36(43-23-13-8-3)34(45-33)32-26-30(19-20-31(32)38(39)40)25-29-17-15-28(10-5)16-18-29/h15-20,26,33-37H,6-14,21-25,27H2,1-5H3,(H,39,40)/t33-,34+,35-,36?,37+/m1/s1 |
| InChIKey | BDKBRQMNCLFARB-AXFRAJIDSA-N |
| XLogP | 8.35 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.88 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|