C40H62O6 — CID 71110681
(2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[6-[(4-methoxyphenyl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-yl]oxane (PubChem CID 71110681) has the molecular formula C40H62O6 and a molecular weight of 638.93 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[6-[(4-methoxyphenyl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-yl]oxane.
| Compound Name | (2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[6-[(4-methoxyphenyl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-yl]oxane |
|---|---|
| PubChem CID | 71110681 |
| Molecular Formula | C40H62O6 |
| Molecular Weight | 638.93 g/mol |
| Exact Mass | 638.45 |
| IUPAC Name | (2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-6-[6-[(4-methoxyphenyl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-yl]oxane |
| SMILES | CCCCOC[C@H]1OC(c2cc(Cc3ccc(OC)cc3)c(C)c3c2CCC3)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C40H62O6/c1-7-11-22-42-28-36-38(43-23-12-8-2)40(45-25-14-10-4)39(44-24-13-9-3)37(46-36)35-27-31(29(5)33-16-15-17-34(33)35)26-30-18-20-32(41-6)21-19-30/h18-21,27,36-40H,7-17,22-26,28H2,1-6H3/t36-,37?,38-,39+,40+/m1/s1 |
| InChIKey | ZJXDAJBSDJUNAV-OLGXHEOYSA-N |
| XLogP | 8.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.93 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|