C38H57ClO7 — CID 90089106
7-chloro-6-[(4-methoxyphenyl)methyl]-4-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]-2,3-dihydro-1-benzofuran (PubChem CID 90089106) has the molecular formula C38H57ClO7 and a molecular weight of 661.32 g/mol. Its IUPAC name is 7-chloro-6-[(4-methoxyphenyl)methyl]-4-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]-2,3-dihydro-1-benzofuran.
| Compound Name | 7-chloro-6-[(4-methoxyphenyl)methyl]-4-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 90089106 |
| Molecular Formula | C38H57ClO7 |
| Molecular Weight | 661.32 g/mol |
| Exact Mass | 660.38 |
| IUPAC Name | 7-chloro-6-[(4-methoxyphenyl)methyl]-4-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]-2,3-dihydro-1-benzofuran |
| SMILES | CCCCOC[C@H]1OC(c2cc(Cc3ccc(OC)cc3)c(Cl)c3c2CCO3)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C38H57ClO7/c1-6-10-19-41-26-32-36(42-20-11-7-2)38(44-22-13-9-4)37(43-21-12-8-3)35(46-32)31-25-28(33(39)34-30(31)18-23-45-34)24-27-14-16-29(40-5)17-15-27/h14-17,25,32,35-38H,6-13,18-24,26H2,1-5H3/t32-,35?,36-,37+,38+/m1/s1 |
| InChIKey | AJHNZZPQYQHENL-WSORBNILSA-N |
| XLogP | 8.69 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.32 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|