C21H23ClO7 — CID 71076929
(2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-hydroxyphenyl)methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71076929) has the molecular formula C21H23ClO7 and a molecular weight of 422.86 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-hydroxyphenyl)methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-hydroxyphenyl)methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71076929 |
| Molecular Formula | C21H23ClO7 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-hydroxyphenyl)methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3ccc(O)cc3)c(Cl)c3c2CCO3)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H23ClO7/c22-16-11(7-10-1-3-12(24)4-2-10)8-14(13-5-6-28-20(13)16)21-19(27)18(26)17(25)15(9-23)29-21/h1-4,8,15,17-19,21,23-27H,5-7,9H2/t15-,17-,18+,19-,21+/m1/s1 |
| InChIKey | JQZNCDFKFILBBV-UVPIGPOJSA-N |
| XLogP | 1.09 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |