C24H29ClO6 — CID 71076953
(2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-propan-2-ylphenyl)methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71076953) has the molecular formula C24H29ClO6 and a molecular weight of 448.94 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-propan-2-ylphenyl)methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-propan-2-ylphenyl)methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71076953 |
| Molecular Formula | C24H29ClO6 |
| Molecular Weight | 448.94 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-propan-2-ylphenyl)methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)c1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(c2Cl)OCC3)cc1 |
| InChI | InChI=1S/C24H29ClO6/c1-12(2)14-5-3-13(4-6-14)9-15-10-17(16-7-8-30-23(16)19(15)25)24-22(29)21(28)20(27)18(11-26)31-24/h3-6,10,12,18,20-22,24,26-29H,7-9,11H2,1-2H3/t18-,20-,21+,22-,24+/m1/s1 |
| InChIKey | ZVXJLRDBQFYLKE-YVTYUBGGSA-N |
| XLogP | 2.50 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.94 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |