C24H27ClO7 — CID 171068562
(2S,3R,4R,5S,6R)-2-[7-chloro-6-[[4-(1-hydroxycyclopropyl)phenyl]methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 171068562) has the molecular formula C24H27ClO7 and a molecular weight of 462.93 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[7-chloro-6-[[4-(1-hydroxycyclopropyl)phenyl]methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[7-chloro-6-[[4-(1-hydroxycyclopropyl)phenyl]methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 171068562 |
| Molecular Formula | C24H27ClO7 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[7-chloro-6-[[4-(1-hydroxycyclopropyl)phenyl]methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3ccc(C4(O)CC4)cc3)c(Cl)c3c2CCO3)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H27ClO7/c25-18-13(9-12-1-3-14(4-2-12)24(30)6-7-24)10-16(15-5-8-31-22(15)18)23-21(29)20(28)19(27)17(11-26)32-23/h1-4,10,17,19-21,23,26-30H,5-9,11H2/t17-,19-,20+,21-,23+/m1/s1 |
| InChIKey | QRVFLBWWMQCRFM-SQKWCZRTSA-N |
| XLogP | 1.36 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |