C29H38F2O6 — CID 122661569
[5-[(2S,4R,5R)-3-butoxy-5-(butoxymethyl)-4-phenylmethoxyoxolan-2-yl]-2,4-difluorophenyl]methyl acetate (PubChem CID 122661569) has the molecular formula C29H38F2O6 and a molecular weight of 520.61 g/mol. Its IUPAC name is [5-[(2S,4R,5R)-3-butoxy-5-(butoxymethyl)-4-phenylmethoxyoxolan-2-yl]-2,4-difluorophenyl]methyl acetate.
| Compound Name | [5-[(2S,4R,5R)-3-butoxy-5-(butoxymethyl)-4-phenylmethoxyoxolan-2-yl]-2,4-difluorophenyl]methyl acetate |
|---|---|
| PubChem CID | 122661569 |
| Molecular Formula | C29H38F2O6 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | [5-[(2S,4R,5R)-3-butoxy-5-(butoxymethyl)-4-phenylmethoxyoxolan-2-yl]-2,4-difluorophenyl]methyl acetate |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cc(COC(C)=O)c(F)cc2F)C(OCCCC)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H38F2O6/c1-4-6-13-33-19-26-28(36-17-21-11-9-8-10-12-21)29(34-14-7-5-2)27(37-26)23-15-22(18-35-20(3)32)24(30)16-25(23)31/h8-12,15-16,26-29H,4-7,13-14,17-19H2,1-3H3/t26-,27+,28-,29?/m1/s1 |
| InChIKey | CLYLHZJLOKEAHL-WZKCMNIOSA-N |
| XLogP | 6.06 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|