C38H56O5S — CID 90396819
(2S,3R,4S,6S)-2-[5-(1-benzothiophen-2-ylmethyl)-2-butoxy-4-methylphenyl]-3,4-dibutoxy-6-(butoxymethyl)oxane (PubChem CID 90396819) has the molecular formula C38H56O5S and a molecular weight of 624.93 g/mol. Its IUPAC name is (2S,3R,4S,6S)-2-[5-(1-benzothiophen-2-ylmethyl)-2-butoxy-4-methylphenyl]-3,4-dibutoxy-6-(butoxymethyl)oxane.
| Compound Name | (2S,3R,4S,6S)-2-[5-(1-benzothiophen-2-ylmethyl)-2-butoxy-4-methylphenyl]-3,4-dibutoxy-6-(butoxymethyl)oxane |
|---|---|
| PubChem CID | 90396819 |
| Molecular Formula | C38H56O5S |
| Molecular Weight | 624.93 g/mol |
| Exact Mass | 624.38 |
| IUPAC Name | (2S,3R,4S,6S)-2-[5-(1-benzothiophen-2-ylmethyl)-2-butoxy-4-methylphenyl]-3,4-dibutoxy-6-(butoxymethyl)oxane |
| SMILES | CCCCOC[C@@H]1C[C@H](OCCCC)[C@@H](OCCCC)[C@H](c2cc(Cc3cc4ccccc4s3)c(C)cc2OCCCC)O1 |
| InChI | InChI=1S/C38H56O5S/c1-6-10-18-39-27-31-26-35(41-20-12-8-3)38(42-21-13-9-4)37(43-31)33-25-30(28(5)22-34(33)40-19-11-7-2)24-32-23-29-16-14-15-17-36(29)44-32/h14-17,22-23,25,31,35,37-38H,6-13,18-21,24,26-27H2,1-5H3/t31-,35-,37-,38+/m0/s1 |
| InChIKey | WBLYVWSOSPEFQW-ISNMDYFRSA-N |
| XLogP | 10.00 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.93 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|