C39H58O7S — CID 89049910
(4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-butoxy-3-methoxy-4-methylphenyl]-4,5-dibutoxy-6-(butoxymethyl)oxan-2-ol (PubChem CID 89049910) has the molecular formula C39H58O7S and a molecular weight of 670.95 g/mol. Its IUPAC name is (4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-butoxy-3-methoxy-4-methylphenyl]-4,5-dibutoxy-6-(butoxymethyl)oxan-2-ol.
| Compound Name | (4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-butoxy-3-methoxy-4-methylphenyl]-4,5-dibutoxy-6-(butoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 89049910 |
| Molecular Formula | C39H58O7S |
| Molecular Weight | 670.95 g/mol |
| Exact Mass | 670.39 |
| IUPAC Name | (4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-2-butoxy-3-methoxy-4-methylphenyl]-4,5-dibutoxy-6-(butoxymethyl)oxan-2-ol |
| SMILES | CCCCOC[C@H]1OC(O)(c2cc(Cc3cc4ccccc4s3)c(C)c(OC)c2OCCCC)C[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C39H58O7S/c1-7-11-19-42-27-34-38(45-22-14-10-4)33(43-20-12-8-2)26-39(40,46-34)32-25-30(24-31-23-29-17-15-16-18-35(29)47-31)28(5)36(41-6)37(32)44-21-13-9-3/h15-18,23,25,33-34,38,40H,7-14,19-22,24,26-27H2,1-6H3/t33-,34-,38+,39?/m1/s1 |
| InChIKey | NRDUPBSSDJQDBC-VSJCJUDYSA-N |
| XLogP | 9.11 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.95 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|