C28H29BrO7S — CID 123713381
[4,5-diacetyloxy-6-[5-(1-benzothiophen-2-ylmethyl)-2-bromo-4-methylphenyl]oxan-2-yl]methyl acetate (PubChem CID 123713381) has the molecular formula C28H29BrO7S and a molecular weight of 589.50 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-[5-(1-benzothiophen-2-ylmethyl)-2-bromo-4-methylphenyl]oxan-2-yl]methyl acetate.
| Compound Name | [4,5-diacetyloxy-6-[5-(1-benzothiophen-2-ylmethyl)-2-bromo-4-methylphenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123713381 |
| Molecular Formula | C28H29BrO7S |
| Molecular Weight | 589.50 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | [4,5-diacetyloxy-6-[5-(1-benzothiophen-2-ylmethyl)-2-bromo-4-methylphenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CC(OC(C)=O)C(OC(C)=O)C(c2cc(Cc3cc4ccccc4s3)c(C)cc2Br)O1 |
| InChI | InChI=1S/C28H29BrO7S/c1-15-9-24(29)23(12-20(15)11-22-10-19-7-5-6-8-26(19)37-22)27-28(35-18(4)32)25(34-17(3)31)13-21(36-27)14-33-16(2)30/h5-10,12,21,25,27-28H,11,13-14H2,1-4H3 |
| InChIKey | FTSRBNWIDLTWHQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|