C27H27ClO8S — CID 155176645
[(2R,3R,4S,5S)-4,5-diacetyloxy-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-3-hydroxyoxan-2-yl]methyl acetate (PubChem CID 155176645) has the molecular formula C27H27ClO8S and a molecular weight of 547.03 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4,5-diacetyloxy-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-3-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S)-4,5-diacetyloxy-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-3-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155176645 |
| Molecular Formula | C27H27ClO8S |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | [(2R,3R,4S,5S)-4,5-diacetyloxy-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-3-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(c2ccc(Cl)c(Cc3cc4ccccc4s3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O |
| InChI | InChI=1S/C27H27ClO8S/c1-14(29)33-13-22-24(32)26(34-15(2)30)27(35-16(3)31)25(36-22)18-8-9-21(28)19(10-18)12-20-11-17-6-4-5-7-23(17)37-20/h4-11,22,24-27,32H,12-13H2,1-3H3/t22-,24-,25?,26+,27+/m1/s1 |
| InChIKey | QLWACOHXKYWCEQ-WFDQJDLHSA-N |
| XLogP | 4.37 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|