C42H32ClFO7S — CID 71130873
[(5S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-4,5-dibenzoyloxy-3-fluorooxan-2-yl]methyl benzoate (PubChem CID 71130873) has the molecular formula C42H32ClFO7S and a molecular weight of 735.23 g/mol. Its IUPAC name is [(5S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-4,5-dibenzoyloxy-3-fluorooxan-2-yl]methyl benzoate.
| Compound Name | [(5S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-4,5-dibenzoyloxy-3-fluorooxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 71130873 |
| Molecular Formula | C42H32ClFO7S |
| Molecular Weight | 735.23 g/mol |
| Exact Mass | 734.15 |
| IUPAC Name | [(5S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-4,5-dibenzoyloxy-3-fluorooxan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1OC(c2ccc(Cl)c(Cc3cc4ccccc4s3)c2)[C@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1F)c1ccccc1 |
| InChI | InChI=1S/C42H32ClFO7S/c43-33-21-20-30(22-31(33)24-32-23-29-18-10-11-19-35(29)52-32)37-39(51-42(47)28-16-8-3-9-17-28)38(50-41(46)27-14-6-2-7-15-27)36(44)34(49-37)25-48-40(45)26-12-4-1-5-13-26/h1-23,34,36-39H,24-25H2/t34?,36?,37?,38?,39-/m0/s1 |
| InChIKey | GCYTVLCFDRGEPS-XWCNRDLNSA-N |
| XLogP | 9.23 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.23 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|