C30H24N2O7 — CID 22865608
[(2S,3S,4R,5R)-3,4-dibenzoyloxy-5-pyrimidin-2-yloxolan-2-yl]methyl benzoate (PubChem CID 22865608) has the molecular formula C30H24N2O7 and a molecular weight of 524.53 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-3,4-dibenzoyloxy-5-pyrimidin-2-yloxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3S,4R,5R)-3,4-dibenzoyloxy-5-pyrimidin-2-yloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 22865608 |
| Molecular Formula | C30H24N2O7 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | [(2S,3S,4R,5R)-3,4-dibenzoyloxy-5-pyrimidin-2-yloxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1O[C@H](c2ncccn2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H24N2O7/c33-28(20-11-4-1-5-12-20)36-19-23-24(38-29(34)21-13-6-2-7-14-21)25(26(37-23)27-31-17-10-18-32-27)39-30(35)22-15-8-3-9-16-22/h1-18,23-26H,19H2/t23-,24-,25-,26-/m0/s1 |
| InChIKey | JFPFDZLHBGMGQU-CQJMVLFOSA-N |
| XLogP | 4.22 |
| TPSA | 113.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|