C29H24N2O8 — CID 134909822
[(2R,3R,4S,5S)-3,4-dibenzoyloxy-5-(5-methyl-1,2,4-oxadiazol-3-yl)oxolan-2-yl]methyl benzoate (PubChem CID 134909822) has the molecular formula C29H24N2O8 and a molecular weight of 528.52 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-dibenzoyloxy-5-(5-methyl-1,2,4-oxadiazol-3-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5S)-3,4-dibenzoyloxy-5-(5-methyl-1,2,4-oxadiazol-3-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 134909822 |
| Molecular Formula | C29H24N2O8 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-dibenzoyloxy-5-(5-methyl-1,2,4-oxadiazol-3-yl)oxolan-2-yl]methyl benzoate |
| SMILES | Cc1nc([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)no1 |
| InChI | InChI=1S/C29H24N2O8/c1-18-30-26(31-39-18)25-24(38-29(34)21-15-9-4-10-16-21)23(37-28(33)20-13-7-3-8-14-20)22(36-25)17-35-27(32)19-11-5-2-6-12-19/h2-16,22-25H,17H2,1H3/t22-,23-,24-,25-/m1/s1 |
| InChIKey | SAMVLNLSUHSMGV-ZGFBMJKBSA-N |
| XLogP | 4.13 |
| TPSA | 127.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|