C42H33ClO8S — CID 71130874
[(3R,5S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-4,5-dibenzoyloxy-3-hydroxyoxan-2-yl]methyl benzoate (PubChem CID 71130874) has the molecular formula C42H33ClO8S and a molecular weight of 733.24 g/mol. Its IUPAC name is [(3R,5S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-4,5-dibenzoyloxy-3-hydroxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3R,5S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-4,5-dibenzoyloxy-3-hydroxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 71130874 |
| Molecular Formula | C42H33ClO8S |
| Molecular Weight | 733.24 g/mol |
| Exact Mass | 732.16 |
| IUPAC Name | [(3R,5S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-4,5-dibenzoyloxy-3-hydroxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1OC(c2ccc(Cl)c(Cc3cc4ccccc4s3)c2)[C@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C42H33ClO8S/c43-33-21-20-30(22-31(33)24-32-23-29-18-10-11-19-35(29)52-32)37-39(51-42(47)28-16-8-3-9-17-28)38(50-41(46)27-14-6-2-7-15-27)36(44)34(49-37)25-48-40(45)26-12-4-1-5-13-26/h1-23,34,36-39,44H,24-25H2/t34?,36-,37?,38?,39+/m1/s1 |
| InChIKey | XCGCETKIBXBXAT-ROIDQJFASA-N |
| XLogP | 8.25 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.24 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|