C43H69NO7SSi — CID 90396839
(3R,4S,6S)-2-[5-[1,3-benzothiazol-2-yl-[tert-butyl(dimethyl)silyl]oxymethyl]-2-butoxy-4-methylphenyl]-3,4-dibutoxy-6-(butoxymethyl)oxan-2-ol (PubChem CID 90396839) has the molecular formula C43H69NO7SSi and a molecular weight of 772.18 g/mol. Its IUPAC name is (3R,4S,6S)-2-[5-[1,3-benzothiazol-2-yl-[tert-butyl(dimethyl)silyl]oxymethyl]-2-butoxy-4-methylphenyl]-3,4-dibutoxy-6-(butoxymethyl)oxan-2-ol.
| Compound Name | (3R,4S,6S)-2-[5-[1,3-benzothiazol-2-yl-[tert-butyl(dimethyl)silyl]oxymethyl]-2-butoxy-4-methylphenyl]-3,4-dibutoxy-6-(butoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 90396839 |
| Molecular Formula | C43H69NO7SSi |
| Molecular Weight | 772.18 g/mol |
| Exact Mass | 771.46 |
| IUPAC Name | (3R,4S,6S)-2-[5-[1,3-benzothiazol-2-yl-[tert-butyl(dimethyl)silyl]oxymethyl]-2-butoxy-4-methylphenyl]-3,4-dibutoxy-6-(butoxymethyl)oxan-2-ol |
| SMILES | CCCCOC[C@@H]1C[C@H](OCCCC)[C@@H](OCCCC)C(O)(c2cc(C(O[Si](C)(C)C(C)(C)C)c3nc4ccccc4s3)c(C)cc2OCCCC)O1 |
| InChI | InChI=1S/C43H69NO7SSi/c1-11-15-23-46-30-32-28-37(48-25-17-13-3)40(49-26-18-14-4)43(45,50-32)34-29-33(31(5)27-36(34)47-24-16-12-2)39(51-53(9,10)42(6,7)8)41-44-35-21-19-20-22-38(35)52-41/h19-22,27,29,32,37,39-40,45H,11-18,23-26,28,30H2,1-10H3/t32-,37-,39?,40+,43?/m0/s1 |
| InChIKey | OCPCSUKUEJGPST-RNISTUSPSA-N |
| XLogP | 11.02 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.18 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|