C43H53NO5SSi — CID 90394978
(3R,4S,6R)-2-[5-[1,3-benzothiazol-2-yl-[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dimethylphenyl]-6-ethyl-3,4-bis(phenylmethoxy)oxan-2-ol (PubChem CID 90394978) has the molecular formula C43H53NO5SSi and a molecular weight of 724.05 g/mol. Its IUPAC name is (3R,4S,6R)-2-[5-[1,3-benzothiazol-2-yl-[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dimethylphenyl]-6-ethyl-3,4-bis(phenylmethoxy)oxan-2-ol.
| Compound Name | (3R,4S,6R)-2-[5-[1,3-benzothiazol-2-yl-[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dimethylphenyl]-6-ethyl-3,4-bis(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 90394978 |
| Molecular Formula | C43H53NO5SSi |
| Molecular Weight | 724.05 g/mol |
| Exact Mass | 723.34 |
| IUPAC Name | (3R,4S,6R)-2-[5-[1,3-benzothiazol-2-yl-[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dimethylphenyl]-6-ethyl-3,4-bis(phenylmethoxy)oxan-2-ol |
| SMILES | CC[C@@H]1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C(O)(c2cc(C(O[Si](C)(C)C(C)(C)C)c3nc4ccccc4s3)c(C)cc2C)O1 |
| InChI | InChI=1S/C43H53NO5SSi/c1-9-33-25-37(46-27-31-18-12-10-13-19-31)40(47-28-32-20-14-11-15-21-32)43(45,48-33)35-26-34(29(2)24-30(35)3)39(49-51(7,8)42(4,5)6)41-44-36-22-16-17-23-38(36)50-41/h10-24,26,33,37,39-40,45H,9,25,27-28H2,1-8H3/t33-,37+,39?,40-,43?/m1/s1 |
| InChIKey | QMDKLISQXSHFHU-KRGXDVHUSA-N |
| XLogP | 10.54 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.05 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|