C20H21BrO3S — CID 90396735
1-benzothiophen-2-yl-(5-bromo-4-butoxy-2-methoxyphenyl)methanol (PubChem CID 90396735) has the molecular formula C20H21BrO3S and a molecular weight of 421.36 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-(5-bromo-4-butoxy-2-methoxyphenyl)methanol.
| Compound Name | 1-benzothiophen-2-yl-(5-bromo-4-butoxy-2-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 90396735 |
| Molecular Formula | C20H21BrO3S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 1-benzothiophen-2-yl-(5-bromo-4-butoxy-2-methoxyphenyl)methanol |
| SMILES | CCCCOc1cc(OC)c(C(O)c2cc3ccccc3s2)cc1Br |
| InChI | InChI=1S/C20H21BrO3S/c1-3-4-9-24-17-12-16(23-2)14(11-15(17)21)20(22)19-10-13-7-5-6-8-18(13)25-19/h5-8,10-12,20,22H,3-4,9H2,1-2H3 |
| InChIKey | BTMIQTBCUKUXTF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|